C15H15FN4O4 — CID 97339035
N-[(5S)-8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-1-methyl-4-nitropyrazole-5-carboxamide (PubChem CID 97339035) has the molecular formula C15H15FN4O4 and a molecular weight of 334.31 g/mol. Its IUPAC name is N-[(5S)-8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-1-methyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[(5S)-8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-1-methyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 97339035 |
| Molecular Formula | C15H15FN4O4 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[(5S)-8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-1-methyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cn1ncc([N+](=O)[O-])c1C(=O)N[C@H]1CCCOc2cc(F)ccc21 |
| InChI | InChI=1S/C15H15FN4O4/c1-19-14(12(8-17-19)20(22)23)15(21)18-11-3-2-6-24-13-7-9(16)4-5-10(11)13/h4-5,7-8,11H,2-3,6H2,1H3,(H,18,21)/t11-/m0/s1 |
| InChIKey | CMWXJNLVSFAIQM-NSHDSACASA-N |
| XLogP | 2.11 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|