C17H23N3O — CID 97340717
N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-3-(pyrazol-1-ylmethyl)aniline (PubChem CID 97340717) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-3-(pyrazol-1-ylmethyl)aniline.
| Compound Name | N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-3-(pyrazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 97340717 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-3-(pyrazol-1-ylmethyl)aniline |
| SMILES | C[C@H]1C[C@H](CNc2cccc(Cn3cccn3)c2)CCO1 |
| InChI | InChI=1S/C17H23N3O/c1-14-10-15(6-9-21-14)12-18-17-5-2-4-16(11-17)13-20-8-3-7-19-20/h2-5,7-8,11,14-15,18H,6,9-10,12-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | JCWDRNCWDLWXLQ-LSDHHAIUSA-N |
| XLogP | 3.16 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |