C22H30N2 — CID 97341089
N-[(1R)-1-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-3-phenylpropan-1-amine (PubChem CID 97341089) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is N-[(1R)-1-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-3-phenylpropan-1-amine.
| Compound Name | N-[(1R)-1-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 97341089 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-[(1R)-1-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-3-phenylpropan-1-amine |
| SMILES | C[C@@H](NCCCc1ccccc1)[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H30N2/c1-19(23-15-8-13-20-9-4-2-5-10-20)22-14-16-24(18-22)17-21-11-6-3-7-12-21/h2-7,9-12,19,22-23H,8,13-18H2,1H3/t19-,22-/m1/s1 |
| InChIKey | PHMREHRVUUJDDC-DENIHFKCSA-N |
| XLogP | 4.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|