About 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide
1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide (PubChem CID 97341239) has the molecular formula C16H21N3O3
and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide |
| PubChem CID | 97341239 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide |
| SMILES | CCN(C(=O)c1cccn1C1CCCC1)[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C16H21N3O3/c1-2-18(13-10-14(20)17-15(13)21)16(22)12-8-5-9-19(12)11-6-3-4-7-11/h5,8-9,11,13H,2-4,6-7,10H2,1H3,(H,17,20,21)/t13-/m0/s1 |
| InChIKey | YZIPTBXRZPSCPC-ZDUSSCGKSA-N |
| XLogP | 1.48 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide?
The IUPAC name of 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide (CID 97341239) is 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide.
What is the SMILES notation for 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide?
The canonical SMILES for 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide is CCN(C(=O)c1cccn1C1CCCC1)[C@H]1CC(=O)NC1=O.
What is the InChIKey of 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide?
The InChIKey is YZIPTBXRZPSCPC-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H21N3O3/c1-2-18(13-10-14(20)17-15(13)21)16(22)12-8-5-9-19(12)11-6-3-4-7-11/h5,8-9,11,13H,2-4,6-7,10H2,1H3,(H,17,20,21)/t13-/m0/s1.
What are the key properties of 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide?
1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide has a molecular weight of 303.36 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethylpyrrole-2-carboxamide is sourced from PubChem (CID 97341239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).