C19H20N4O3 — CID 97342704
5-(methoxymethyl)-N-[(6S)-3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]furan-2-carboxamide (PubChem CID 97342704) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[(6S)-3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[(6S)-3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 97342704 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 5-(methoxymethyl)-N-[(6S)-3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)N[C@H]2CCc3nnc(-c4ccccc4)n3C2)o1 |
| InChI | InChI=1S/C19H20N4O3/c1-25-12-15-8-9-16(26-15)19(24)20-14-7-10-17-21-22-18(23(17)11-14)13-5-3-2-4-6-13/h2-6,8-9,14H,7,10-12H2,1H3,(H,20,24)/t14-/m0/s1 |
| InChIKey | YYZVCOGHUBKHOQ-AWEZNQCLSA-N |
| XLogP | 2.43 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |