C11H17ClN2O3 — CID 119450206
5-(methoxymethyl)-N-pyrrolidin-3-ylfuran-2-carboxamide;hydrochloride (PubChem CID 119450206) has the molecular formula C11H17ClN2O3 and a molecular weight of 260.72 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-pyrrolidin-3-ylfuran-2-carboxamide;hydrochloride.
| Compound Name | 5-(methoxymethyl)-N-pyrrolidin-3-ylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119450206 |
| Molecular Formula | C11H17ClN2O3 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-(methoxymethyl)-N-pyrrolidin-3-ylfuran-2-carboxamide;hydrochloride |
| SMILES | COCc1ccc(C(=O)NC2CCNC2)o1.Cl |
| InChI | InChI=1S/C11H16N2O3.ClH/c1-15-7-9-2-3-10(16-9)11(14)13-8-4-5-12-6-8;/h2-3,8,12H,4-7H2,1H3,(H,13,14);1H |
| InChIKey | JUPOTIDQRGFLLO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |