C21H24N6O — CID 97342742
N-[(6S)-3-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2-(dimethylamino)pyridine-3-carboxamide (PubChem CID 97342742) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(6S)-3-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2-(dimethylamino)pyridine-3-carboxamide.
| Compound Name | N-[(6S)-3-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2-(dimethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 97342742 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[(6S)-3-benzyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2-(dimethylamino)pyridine-3-carboxamide |
| SMILES | CN(C)c1ncccc1C(=O)N[C@H]1CCc2nnc(Cc3ccccc3)n2C1 |
| InChI | InChI=1S/C21H24N6O/c1-26(2)20-17(9-6-12-22-20)21(28)23-16-10-11-18-24-25-19(27(18)14-16)13-15-7-4-3-5-8-15/h3-9,12,16H,10-11,13-14H2,1-2H3,(H,23,28)/t16-/m0/s1 |
| InChIKey | KGXPOCZXRACKHV-INIZCTEOSA-N |
| XLogP | 2.07 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |