C20H29N3O4S — CID 97342786
(3R)-3-[4-(2-methylsulfonylbenzoyl)piperazin-1-yl]-1-propan-2-ylpiperidin-2-one (PubChem CID 97342786) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is (3R)-3-[4-(2-methylsulfonylbenzoyl)piperazin-1-yl]-1-propan-2-ylpiperidin-2-one.
| Compound Name | (3R)-3-[4-(2-methylsulfonylbenzoyl)piperazin-1-yl]-1-propan-2-ylpiperidin-2-one |
|---|---|
| PubChem CID | 97342786 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (3R)-3-[4-(2-methylsulfonylbenzoyl)piperazin-1-yl]-1-propan-2-ylpiperidin-2-one |
| SMILES | CC(C)N1CCC[C@@H](N2CCN(C(=O)c3ccccc3S(C)(=O)=O)CC2)C1=O |
| InChI | InChI=1S/C20H29N3O4S/c1-15(2)23-10-6-8-17(20(23)25)21-11-13-22(14-12-21)19(24)16-7-4-5-9-18(16)28(3,26)27/h4-5,7,9,15,17H,6,8,10-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | ARYYIYPRTRQOLK-QGZVFWFLSA-N |
| XLogP | 1.25 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |