C23H29N3O3S — CID 78857211
2-(4-cyclopentylpiperazine-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide (PubChem CID 78857211) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-(4-cyclopentylpiperazine-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide.
| Compound Name | 2-(4-cyclopentylpiperazine-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 78857211 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(4-cyclopentylpiperazine-1-carbonyl)-N-methyl-N-phenylbenzenesulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccccc1C(=O)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C23H29N3O3S/c1-24(19-9-3-2-4-10-19)30(28,29)22-14-8-7-13-21(22)23(27)26-17-15-25(16-18-26)20-11-5-6-12-20/h2-4,7-10,13-14,20H,5-6,11-12,15-18H2,1H3 |
| InChIKey | HQQJMZRWNCVGDC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |