C17H29N5O4S — CID 97344342
(3R)-N-(1-tert-butylpyrazol-4-yl)-3-morpholin-4-ylsulfonylpiperidine-1-carboxamide (PubChem CID 97344342) has the molecular formula C17H29N5O4S and a molecular weight of 399.52 g/mol. Its IUPAC name is (3R)-N-(1-tert-butylpyrazol-4-yl)-3-morpholin-4-ylsulfonylpiperidine-1-carboxamide.
| Compound Name | (3R)-N-(1-tert-butylpyrazol-4-yl)-3-morpholin-4-ylsulfonylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 97344342 |
| Molecular Formula | C17H29N5O4S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (3R)-N-(1-tert-butylpyrazol-4-yl)-3-morpholin-4-ylsulfonylpiperidine-1-carboxamide |
| SMILES | CC(C)(C)n1cc(NC(=O)N2CCC[C@@H](S(=O)(=O)N3CCOCC3)C2)cn1 |
| InChI | InChI=1S/C17H29N5O4S/c1-17(2,3)22-12-14(11-18-22)19-16(23)20-6-4-5-15(13-20)27(24,25)21-7-9-26-10-8-21/h11-12,15H,4-10,13H2,1-3H3,(H,19,23)/t15-/m1/s1 |
| InChIKey | WEPYLGYFYSXOIN-OAHLLOKOSA-N |
| XLogP | 1.30 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |