C18H20F3N3O2 — CID 97346993
2-(2-methoxyphenyl)-N-[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]acetamide (PubChem CID 97346993) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-N-[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]acetamide.
| Compound Name | 2-(2-methoxyphenyl)-N-[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]acetamide |
|---|---|
| PubChem CID | 97346993 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-(2-methoxyphenyl)-N-[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]acetamide |
| SMILES | COc1ccccc1CC(=O)N[C@@H]1CCCc2cn(CC(F)(F)F)nc21 |
| InChI | InChI=1S/C18H20F3N3O2/c1-26-15-8-3-2-5-12(15)9-16(25)22-14-7-4-6-13-10-24(23-17(13)14)11-18(19,20)21/h2-3,5,8,10,14H,4,6-7,9,11H2,1H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | TYJQAYCGSLHOFA-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |