C16H22F3N5O2 — CID 166217677
4-methyl-3-oxo-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]-1,4-diazepane-1-carboxamide (PubChem CID 166217677) has the molecular formula C16H22F3N5O2 and a molecular weight of 373.38 g/mol. Its IUPAC name is 4-methyl-3-oxo-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-methyl-3-oxo-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 166217677 |
| Molecular Formula | C16H22F3N5O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 4-methyl-3-oxo-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]-1,4-diazepane-1-carboxamide |
| SMILES | CN1CCCN(C(=O)NC2CCCc3cn(CC(F)(F)F)nc32)CC1=O |
| InChI | InChI=1S/C16H22F3N5O2/c1-22-6-3-7-23(9-13(22)25)15(26)20-12-5-2-4-11-8-24(21-14(11)12)10-16(17,18)19/h8,12H,2-7,9-10H2,1H3,(H,20,26) |
| InChIKey | LVESMSINPRBZPE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |