C16H21F3N4S — CID 97346769
(7R)-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine (PubChem CID 97346769) has the molecular formula C16H21F3N4S and a molecular weight of 358.43 g/mol. Its IUPAC name is (7R)-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine.
| Compound Name | (7R)-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine |
|---|---|
| PubChem CID | 97346769 |
| Molecular Formula | C16H21F3N4S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (7R)-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine |
| SMILES | CC(C)c1ncc(CN[C@@H]2CCCc3cn(CC(F)(F)F)nc32)s1 |
| InChI | InChI=1S/C16H21F3N4S/c1-10(2)15-21-7-12(24-15)6-20-13-5-3-4-11-8-23(22-14(11)13)9-16(17,18)19/h7-8,10,13,20H,3-6,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | HZDOYLURBPONJZ-CYBMUJFWSA-N |
| XLogP | 4.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |