C10H15F3N2S — CID 115694089
3,3,3-trifluoro-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]propan-1-amine (PubChem CID 115694089) has the molecular formula C10H15F3N2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115694089 |
| Molecular Formula | C10H15F3N2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3,3,3-trifluoro-N-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]propan-1-amine |
| SMILES | CC(C)c1ncc(CNCCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H15F3N2S/c1-7(2)9-15-6-8(16-9)5-14-4-3-10(11,12)13/h6-7,14H,3-5H2,1-2H3 |
| InChIKey | ALYXKJAWKIAPLE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|