C14H15F3N4O2S — CID 97346822
N-[(7S)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]pyridine-3-sulfonamide (PubChem CID 97346822) has the molecular formula C14H15F3N4O2S and a molecular weight of 360.36 g/mol. Its IUPAC name is N-[(7S)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]pyridine-3-sulfonamide.
| Compound Name | N-[(7S)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 97346822 |
| Molecular Formula | C14H15F3N4O2S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[(7S)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCc2cn(CC(F)(F)F)nc21)c1cccnc1 |
| InChI | InChI=1S/C14H15F3N4O2S/c15-14(16,17)9-21-8-10-3-1-5-12(13(10)19-21)20-24(22,23)11-4-2-6-18-7-11/h2,4,6-8,12,20H,1,3,5,9H2/t12-/m0/s1 |
| InChIKey | CQUYQWWTGPIWQH-LBPRGKRZSA-N |
| XLogP | 2.20 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |