C16H17F4N3 — CID 97346771
(7R)-N-[(3-fluorophenyl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine (PubChem CID 97346771) has the molecular formula C16H17F4N3 and a molecular weight of 327.32 g/mol. Its IUPAC name is (7R)-N-[(3-fluorophenyl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine.
| Compound Name | (7R)-N-[(3-fluorophenyl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine |
|---|---|
| PubChem CID | 97346771 |
| Molecular Formula | C16H17F4N3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (7R)-N-[(3-fluorophenyl)methyl]-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-amine |
| SMILES | Fc1cccc(CN[C@@H]2CCCc3cn(CC(F)(F)F)nc32)c1 |
| InChI | InChI=1S/C16H17F4N3/c17-13-5-1-3-11(7-13)8-21-14-6-2-4-12-9-23(22-15(12)14)10-16(18,19)20/h1,3,5,7,9,14,21H,2,4,6,8,10H2/t14-/m1/s1 |
| InChIKey | YGJDBTOLRARGIM-CQSZACIVSA-N |
| XLogP | 3.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |