C15H14F3N5 — CID 97346523
2-[[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]pyridine-3-carbonitrile (PubChem CID 97346523) has the molecular formula C15H14F3N5 and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-[[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-[[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97346523 |
| Molecular Formula | C15H14F3N5 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[[(7R)-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N[C@@H]1CCCc2cn(CC(F)(F)F)nc21 |
| InChI | InChI=1S/C15H14F3N5/c16-15(17,18)9-23-8-11-3-1-5-12(13(11)22-23)21-14-10(7-19)4-2-6-20-14/h2,4,6,8,12H,1,3,5,9H2,(H,20,21)/t12-/m1/s1 |
| InChIKey | JBCOGMVLEWLHAL-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |