C15H19N3O2 — CID 97347731
1-[(1S,2S)-2-cyanocyclopentyl]-3-(2-ethoxyphenyl)urea (PubChem CID 97347731) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[(1S,2S)-2-cyanocyclopentyl]-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-[(1S,2S)-2-cyanocyclopentyl]-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 97347731 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[(1S,2S)-2-cyanocyclopentyl]-3-(2-ethoxyphenyl)urea |
| SMILES | CCOc1ccccc1NC(=O)N[C@H]1CCC[C@@H]1C#N |
| InChI | InChI=1S/C15H19N3O2/c1-2-20-14-9-4-3-7-13(14)18-15(19)17-12-8-5-6-11(12)10-16/h3-4,7,9,11-12H,2,5-6,8H2,1H3,(H2,17,18,19)/t11-,12+/m1/s1 |
| InChIKey | JYMYAJCSGMDJGF-NEPJUHHUSA-N |
| XLogP | 2.90 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |