About (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate
(1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 97347777) has the molecular formula C18H25NO3
and a molecular weight of 303.40 g/mol. Its IUPAC name is (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate.
Molecular Properties
| Compound Name | (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate |
| PubChem CID | 97347777 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CN1CCC(C)(COC(=O)[C@@H]2CCOc3ccccc32)CC1 |
| InChI | InChI=1S/C18H25NO3/c1-18(8-10-19(2)11-9-18)13-22-17(20)15-7-12-21-16-6-4-3-5-14(15)16/h3-6,15H,7-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | FVLVOKOXFJKKRC-OAHLLOKOSA-N |
| XLogP | 2.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate?
The IUPAC name of (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate (CID 97347777) is (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate.
What is the SMILES notation for (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate?
The canonical SMILES for (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate is CN1CCC(C)(COC(=O)[C@@H]2CCOc3ccccc32)CC1.
What is the InChIKey of (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate?
The InChIKey is FVLVOKOXFJKKRC-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H25NO3/c1-18(8-10-19(2)11-9-18)13-22-17(20)15-7-12-21-16-6-4-3-5-14(15)16/h3-6,15H,7-13H2,1-2H3/t15-/m1/s1.
What are the key properties of (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate?
(1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate has a molecular weight of 303.40 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethylpiperidin-4-yl)methyl (4R)-3,4-dihydro-2H-chromene-4-carboxylate is sourced from PubChem (CID 97347777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).