C18H27NO5 — CID 97352162
ethyl (3R)-3-hydroxy-4-[4-(4-methoxyphenyl)butanoylamino]-3-methylbutanoate (PubChem CID 97352162) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl (3R)-3-hydroxy-4-[4-(4-methoxyphenyl)butanoylamino]-3-methylbutanoate.
| Compound Name | ethyl (3R)-3-hydroxy-4-[4-(4-methoxyphenyl)butanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 97352162 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ethyl (3R)-3-hydroxy-4-[4-(4-methoxyphenyl)butanoylamino]-3-methylbutanoate |
| SMILES | CCOC(=O)C[C@@](C)(O)CNC(=O)CCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H27NO5/c1-4-24-17(21)12-18(2,22)13-19-16(20)7-5-6-14-8-10-15(23-3)11-9-14/h8-11,22H,4-7,12-13H2,1-3H3,(H,19,20)/t18-/m1/s1 |
| InChIKey | GXGSFRRNVIEKEA-GOSISDBHSA-N |
| XLogP | 1.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |