C15H16F3NO3 — CID 97355286
methyl (3R)-1-[2-(trifluoromethyl)benzoyl]piperidine-3-carboxylate (PubChem CID 97355286) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is methyl (3R)-1-[2-(trifluoromethyl)benzoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3R)-1-[2-(trifluoromethyl)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 97355286 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl (3R)-1-[2-(trifluoromethyl)benzoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN(C(=O)c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H16F3NO3/c1-22-14(21)10-5-4-8-19(9-10)13(20)11-6-2-3-7-12(11)15(16,17)18/h2-3,6-7,10H,4-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | PUJNQQYTRFRNBB-SNVBAGLBSA-N |
| XLogP | 2.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |