C17H22N2O4 — CID 973568
3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 973568) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 973568 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | C/C=C/c1ccc(OCCN2C(=O)NC(C)(C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-5-6-12-7-8-13(14(11-12)22-4)23-10-9-19-15(20)17(2,3)18-16(19)21/h5-8,11H,9-10H2,1-4H3,(H,18,21)/b6-5+ |
| InChIKey | VRXXESWQWAFKSV-AATRIKPKSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|