C20H18N4O2 — CID 97359293
(Z)-N-[4-(methylcarbamoylamino)phenyl]-3-quinolin-4-ylprop-2-enamide (PubChem CID 97359293) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is (Z)-N-[4-(methylcarbamoylamino)phenyl]-3-quinolin-4-ylprop-2-enamide.
| Compound Name | (Z)-N-[4-(methylcarbamoylamino)phenyl]-3-quinolin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 97359293 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (Z)-N-[4-(methylcarbamoylamino)phenyl]-3-quinolin-4-ylprop-2-enamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)/C=C\c2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-21-20(26)24-16-9-7-15(8-10-16)23-19(25)11-6-14-12-13-22-18-5-3-2-4-17(14)18/h2-13H,1H3,(H,23,25)(H2,21,24,26)/b11-6- |
| InChIKey | GSLSNZCLPPFKSA-WDZFZDKYSA-N |
| XLogP | 3.64 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|