C14H13N — CID 123171644
4-(3-methylbuta-1,3-dienyl)quinoline (PubChem CID 123171644) has the molecular formula C14H13N and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-(3-methylbuta-1,3-dienyl)quinoline.
| Compound Name | 4-(3-methylbuta-1,3-dienyl)quinoline |
|---|---|
| PubChem CID | 123171644 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 4-(3-methylbuta-1,3-dienyl)quinoline |
| SMILES | C=C(C)C=Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C14H13N/c1-11(2)7-8-12-9-10-15-14-6-4-3-5-13(12)14/h3-10H,1H2,2H3 |
| InChIKey | IURVWOWVFRZGJI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|