C16H15NO2S — CID 97359635
4-methyl-2-[(1Z,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 97359635) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-methyl-2-[(1Z,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-methyl-2-[(1Z,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 97359635 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-methyl-2-[(1Z,3Z)-3-methyl-4-phenylbuta-1,3-dienyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(/C=C\c1nc(C)c(C(=O)O)s1)=C/c1ccccc1 |
| InChI | InChI=1S/C16H15NO2S/c1-11(10-13-6-4-3-5-7-13)8-9-14-17-12(2)15(20-14)16(18)19/h3-10H,1-2H3,(H,18,19)/b9-8-,11-10- |
| InChIKey | ARXDRZNZILLUSV-XESWYYRISA-N |
| XLogP | 4.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|