C21H18N4O6 — CID 97359683
ethyl 4-amino-2-[[(E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-6-methylfuro[2,3-d]pyrimidine-5-carboxylate (PubChem CID 97359683) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is ethyl 4-amino-2-[[(E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-6-methylfuro[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[[(E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-6-methylfuro[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 97359683 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | ethyl 4-amino-2-[[(E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-6-methylfuro[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2nc(COC(=O)/C(C#N)=C/c3ccc(O)cc3)nc(N)c12 |
| InChI | InChI=1S/C21H18N4O6/c1-3-29-21(28)16-11(2)31-19-17(16)18(23)24-15(25-19)10-30-20(27)13(9-22)8-12-4-6-14(26)7-5-12/h4-8,26H,3,10H2,1-2H3,(H2,23,24,25)/b13-8+ |
| InChIKey | OCLVIMRXUUTTNI-MDWZMJQESA-N |
| XLogP | 2.65 |
| TPSA | 161.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|