C26H30N6O2 — CID 97361473
4-(cyclopropylmethyl)-N-(3-morpholin-4-ylpropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide (PubChem CID 97361473) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-N-(3-morpholin-4-ylpropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide.
| Compound Name | 4-(cyclopropylmethyl)-N-(3-morpholin-4-ylpropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 97361473 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 4-(cyclopropylmethyl)-N-(3-morpholin-4-ylpropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc2c(c3ccccc3n2CC2CC2)n1-c1ncccn1 |
| InChI | InChI=1S/C26H30N6O2/c33-25(27-11-4-12-30-13-15-34-16-14-30)23-17-22-24(32(23)26-28-9-3-10-29-26)20-5-1-2-6-21(20)31(22)18-19-7-8-19/h1-3,5-6,9-10,17,19H,4,7-8,11-16,18H2,(H,27,33) |
| InChIKey | RBORNBSFFDXWHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|