C24H27N5O2 — CID 97361469
4-(cyclopropylmethyl)-N-(3-ethoxypropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide (PubChem CID 97361469) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-N-(3-ethoxypropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide.
| Compound Name | 4-(cyclopropylmethyl)-N-(3-ethoxypropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 97361469 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-(cyclopropylmethyl)-N-(3-ethoxypropyl)-1-pyrimidin-2-ylpyrrolo[3,2-b]indole-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1cc2c(c3ccccc3n2CC2CC2)n1-c1ncccn1 |
| InChI | InChI=1S/C24H27N5O2/c1-2-31-14-6-13-25-23(30)21-15-20-22(29(21)24-26-11-5-12-27-24)18-7-3-4-8-19(18)28(20)16-17-9-10-17/h3-5,7-8,11-12,15,17H,2,6,9-10,13-14,16H2,1H3,(H,25,30) |
| InChIKey | HQDDVESXCLUGRT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|