C21H26N4O — CID 142734736
N-octyl-1-pyrimidin-2-ylindole-2-carboxamide (PubChem CID 142734736) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-octyl-1-pyrimidin-2-ylindole-2-carboxamide.
| Compound Name | N-octyl-1-pyrimidin-2-ylindole-2-carboxamide |
|---|---|
| PubChem CID | 142734736 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-octyl-1-pyrimidin-2-ylindole-2-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1cc2ccccc2n1-c1ncccn1 |
| InChI | InChI=1S/C21H26N4O/c1-2-3-4-5-6-9-13-22-20(26)19-16-17-11-7-8-12-18(17)25(19)21-23-14-10-15-24-21/h7-8,10-12,14-16H,2-6,9,13H2,1H3,(H,22,26) |
| InChIKey | RYTCPKOCGPDNLW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|