C21H18FN3O4 — CID 97361846
3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-(3-methoxypropyl)-1,2-benzoxazole-5-carboxamide (PubChem CID 97361846) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-(3-methoxypropyl)-1,2-benzoxazole-5-carboxamide.
| Compound Name | 3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-(3-methoxypropyl)-1,2-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 97361846 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-(3-methoxypropyl)-1,2-benzoxazole-5-carboxamide |
| SMILES | COCCCNC(=O)c1ccc2onc(-c3coc(-c4ccc(F)cc4)n3)c2c1 |
| InChI | InChI=1S/C21H18FN3O4/c1-27-10-2-9-23-20(26)14-5-8-18-16(11-14)19(25-29-18)17-12-28-21(24-17)13-3-6-15(22)7-4-13/h3-8,11-12H,2,9-10H2,1H3,(H,23,26) |
| InChIKey | ZIXJZWNSDKDJOJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|