About N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide
N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide (PubChem CID 97407378) has the molecular formula C16H18N4O3
and a molecular weight of 314.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide |
| PubChem CID | 97407378 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide |
| SMILES | Cc1nc(-c2noc3ccc(C(=O)NCCN(C)C)cc23)co1 |
| InChI | InChI=1S/C16H18N4O3/c1-10-18-13(9-22-10)15-12-8-11(4-5-14(12)23-19-15)16(21)17-6-7-20(2)3/h4-5,8-9H,6-7H2,1-3H3,(H,17,21) |
| InChIKey | JCPBUXNHAMAPQP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide?
The IUPAC name of N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide (CID 97407378) is N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide?
The canonical SMILES for N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide is Cc1nc(-c2noc3ccc(C(=O)NCCN(C)C)cc23)co1.
What is the InChIKey of N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide?
The InChIKey is JCPBUXNHAMAPQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O3/c1-10-18-13(9-22-10)15-12-8-11(4-5-14(12)23-19-15)16(21)17-6-7-20(2)3/h4-5,8-9H,6-7H2,1-3H3,(H,17,21).
What are the key properties of N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide?
N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide has a molecular weight of 314.35 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]-3-(2-methyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide is sourced from PubChem (CID 97407378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).