C19H22N4O3 — CID 134367336
N-[4-(diethylamino)phenyl]-5-methyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2-oxazole-4-carboxamide (PubChem CID 134367336) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-5-methyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-5-methyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 134367336 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-5-methyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2-oxazole-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2c(-c3coc(C)n3)noc2C)cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-5-23(6-2)15-9-7-14(8-10-15)21-19(24)17-12(3)26-22-18(17)16-11-25-13(4)20-16/h7-11H,5-6H2,1-4H3,(H,21,24) |
| InChIKey | FPULPSASIZNWKZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|