C22H20FN3O4 — CID 97361847
N-(3-ethoxypropyl)-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide (PubChem CID 97361847) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 97361847 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-(3-ethoxypropyl)-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc2onc(-c3coc(-c4ccc(F)cc4)n3)c2c1 |
| InChI | InChI=1S/C22H20FN3O4/c1-2-28-11-3-10-24-21(27)15-6-9-19-17(12-15)20(26-30-19)18-13-29-22(25-18)14-4-7-16(23)8-5-14/h4-9,12-13H,2-3,10-11H2,1H3,(H,24,27) |
| InChIKey | LJLNPBIKRKUFDS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|