C22H21FN4O3 — CID 97361851
N-[3-(dimethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide (PubChem CID 97361851) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 97361851 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc2onc(-c3coc(-c4ccc(F)cc4)n3)c2c1 |
| InChI | InChI=1S/C22H21FN4O3/c1-27(2)11-3-10-24-21(28)15-6-9-19-17(12-15)20(26-30-19)18-13-29-22(25-18)14-4-7-16(23)8-5-14/h4-9,12-13H,3,10-11H2,1-2H3,(H,24,28) |
| InChIKey | WDZQTQBMDRZTEW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|