C24H25FN4O3 — CID 97361853
N-[3-(diethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide (PubChem CID 97361853) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 97361853 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazole-5-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2onc(-c3coc(-c4ccc(F)cc4)n3)c2c1 |
| InChI | InChI=1S/C24H25FN4O3/c1-3-29(4-2)13-5-12-26-23(30)17-8-11-21-19(14-17)22(28-32-21)20-15-31-24(27-20)16-6-9-18(25)10-7-16/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,26,30) |
| InChIKey | MMPDBTZZXKQQNY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|