C19H28N4O2 — CID 97362387
N-(3-ethoxypropyl)-3-(4-methylpiperazin-1-yl)indolizine-6-carboxamide (PubChem CID 97362387) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-(4-methylpiperazin-1-yl)indolizine-6-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-3-(4-methylpiperazin-1-yl)indolizine-6-carboxamide |
|---|---|
| PubChem CID | 97362387 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-(3-ethoxypropyl)-3-(4-methylpiperazin-1-yl)indolizine-6-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc2ccc(N3CCN(C)CC3)n2c1 |
| InChI | InChI=1S/C19H28N4O2/c1-3-25-14-4-9-20-19(24)16-5-6-17-7-8-18(23(17)15-16)22-12-10-21(2)11-13-22/h5-8,15H,3-4,9-14H2,1-2H3,(H,20,24) |
| InChIKey | VAFCMWNSWYQXNC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|