C17H27FN4O2 — CID 97363517
2-[[(4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine (PubChem CID 97363517) has the molecular formula C17H27FN4O2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[[(4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[(4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 97363517 |
| Molecular Formula | C17H27FN4O2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[[(4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC[C@]12CCCO[C@H]1CCN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C17H27FN4O2/c1-21(2)7-9-23-13-17-5-3-8-24-15(17)4-6-22(12-17)16-19-10-14(18)11-20-16/h10-11,15H,3-9,12-13H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | BIKOPFBPLLYMBT-DOTOQJQBSA-N |
| XLogP | 1.57 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|