C16H25FN4O — CID 97364490
(4aS,8R,8aS)-N,N-diethyl-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine (PubChem CID 97364490) has the molecular formula C16H25FN4O and a molecular weight of 308.40 g/mol. Its IUPAC name is (4aS,8R,8aS)-N,N-diethyl-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine.
| Compound Name | (4aS,8R,8aS)-N,N-diethyl-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
|---|---|
| PubChem CID | 97364490 |
| Molecular Formula | C16H25FN4O |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (4aS,8R,8aS)-N,N-diethyl-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
| SMILES | CCN(CC)[C@@H]1CN(c2ncc(F)cn2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C16H25FN4O/c1-3-20(4-2)14-11-21(16-18-8-13(17)9-19-16)10-12-6-5-7-22-15(12)14/h8-9,12,14-15H,3-7,10-11H2,1-2H3/t12-,14+,15-/m0/s1 |
| InChIKey | RGRCHZXORQNLSA-CFVMTHIKSA-N |
| XLogP | 1.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |