C18H27FN4O2 — CID 131660511
N-(5-fluoropyrimidin-2-yl)-9-(oxan-4-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine (PubChem CID 131660511) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is N-(5-fluoropyrimidin-2-yl)-9-(oxan-4-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine.
| Compound Name | N-(5-fluoropyrimidin-2-yl)-9-(oxan-4-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 131660511 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-(5-fluoropyrimidin-2-yl)-9-(oxan-4-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-3-amine |
| SMILES | Fc1cnc(NC2COC3(CCCN(CC4CCOCC4)C3)C2)nc1 |
| InChI | InChI=1S/C18H27FN4O2/c19-15-9-20-17(21-10-15)22-16-8-18(25-12-16)4-1-5-23(13-18)11-14-2-6-24-7-3-14/h9-10,14,16H,1-8,11-13H2,(H,20,21,22) |
| InChIKey | OBMSIIRJZUVDBG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |