About 1-benzyl-4-nitropyrazole
1-benzyl-4-nitropyrazole (PubChem CID 973645) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 1-benzyl-4-nitropyrazole.
Molecular Properties
| Compound Name | 1-benzyl-4-nitropyrazole |
| PubChem CID | 973645 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1-benzyl-4-nitropyrazole |
| SMILES | O=[N+]([O-])c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C10H9N3O2/c14-13(15)10-6-11-12(8-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2 |
| InChIKey | IYZHZCMFLIKMSN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-nitropyrazole?
The IUPAC name of 1-benzyl-4-nitropyrazole (CID 973645) is 1-benzyl-4-nitropyrazole.
What is the SMILES notation for 1-benzyl-4-nitropyrazole?
The canonical SMILES for 1-benzyl-4-nitropyrazole is O=[N+]([O-])c1cnn(Cc2ccccc2)c1.
What is the InChIKey of 1-benzyl-4-nitropyrazole?
The InChIKey is IYZHZCMFLIKMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c14-13(15)10-6-11-12(8-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2.
What are the key properties of 1-benzyl-4-nitropyrazole?
1-benzyl-4-nitropyrazole has a molecular weight of 203.20 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-nitropyrazole is sourced from PubChem (CID 973645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).