C17H23N5O2 — CID 97366339
(3R,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97366339) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3R,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3R,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97366339 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (3R,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1cnc(N2C[C@@H](OCCCn3cccn3)[C@H]3OCCC[C@H]32)nc1 |
| InChI | InChI=1S/C17H23N5O2/c1-5-14-16(24-11-1)15(13-22(14)17-18-6-2-7-19-17)23-12-4-10-21-9-3-8-20-21/h2-3,6-9,14-16H,1,4-5,10-13H2/t14-,15-,16+/m1/s1 |
| InChIKey | KEWNRWDVSZEVBO-OAGGEKHMSA-N |
| XLogP | 1.52 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|