C18H26N2O3 — CID 97366376
(3R,3aS,7aR)-1-(oxan-4-ylmethyl)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97366376) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-(oxan-4-ylmethyl)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3R,3aS,7aR)-1-(oxan-4-ylmethyl)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97366376 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (3R,3aS,7aR)-1-(oxan-4-ylmethyl)-3-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1ccc(O[C@@H]2CN(CC3CCOCC3)[C@@H]3CCCO[C@@H]32)nc1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-8-19-17(5-1)23-16-13-20(12-14-6-10-21-11-7-14)15-4-3-9-22-18(15)16/h1-2,5,8,14-16,18H,3-4,6-7,9-13H2/t15-,16-,18+/m1/s1 |
| InChIKey | RACTXDBLIGAEKP-NUJGCVRESA-N |
| XLogP | 2.12 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |