C14H16FN5O2 — CID 97366496
(2R,3aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine (PubChem CID 97366496) has the molecular formula C14H16FN5O2 and a molecular weight of 305.31 g/mol. Its IUPAC name is (2R,3aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine.
| Compound Name | (2R,3aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 97366496 |
| Molecular Formula | C14H16FN5O2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2R,3aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
| SMILES | Cc1noc([C@H]2C[C@@H]3CCN(c4ncc(F)cn4)C[C@H]3O2)n1 |
| InChI | InChI=1S/C14H16FN5O2/c1-8-18-13(22-19-8)11-4-9-2-3-20(7-12(9)21-11)14-16-5-10(15)6-17-14/h5-6,9,11-12H,2-4,7H2,1H3/t9-,11+,12+/m0/s1 |
| InChIKey | YXIJHPOQPWFQKD-MVWJERBFSA-N |
| XLogP | 1.66 |
| TPSA | 77.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |