C16H18FN5O2 — CID 97415471
(2S,3aS,7aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine (PubChem CID 97415471) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is (2S,3aS,7aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine.
| Compound Name | (2S,3aS,7aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 97415471 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (2S,3aS,7aS)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
| SMILES | Fc1cnc(N2CC[C@H]3C[C@@H](c4nnc(C5CC5)o4)O[C@@H]3C2)nc1 |
| InChI | InChI=1S/C16H18FN5O2/c17-11-6-18-16(19-7-11)22-4-3-10-5-12(23-13(10)8-22)15-21-20-14(24-15)9-1-2-9/h6-7,9-10,12-13H,1-5,8H2/t10-,12-,13+/m0/s1 |
| InChIKey | XJTGVYXSNCYILN-WCFLWFBJSA-N |
| XLogP | 2.23 |
| TPSA | 77.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |