C15H18FN5O2 — CID 97369256
(2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 97369256) has the molecular formula C15H18FN5O2 and a molecular weight of 319.34 g/mol. Its IUPAC name is (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 97369256 |
| Molecular Formula | C15H18FN5O2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | CC(C)c1nnc([C@@H]2C[C@H]3CN(c4ncc(F)cn4)C[C@H]3O2)o1 |
| InChI | InChI=1S/C15H18FN5O2/c1-8(2)13-19-20-14(23-13)11-3-9-6-21(7-12(9)22-11)15-17-4-10(16)5-18-15/h4-5,8-9,11-12H,3,6-7H2,1-2H3/t9-,11-,12+/m0/s1 |
| InChIKey | XMCJHGWOHMLIAM-ZMLRMANQSA-N |
| XLogP | 2.09 |
| TPSA | 77.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |