C10H19N3O3S — CID 97369159
(3aS,7R,7aR)-N,N,7-trimethyl-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-sulfonamide (PubChem CID 97369159) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is (3aS,7R,7aR)-N,N,7-trimethyl-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-sulfonamide.
| Compound Name | (3aS,7R,7aR)-N,N,7-trimethyl-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 97369159 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (3aS,7R,7aR)-N,N,7-trimethyl-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-sulfonamide |
| SMILES | C[C@H]1C(=O)NC[C@H]2CN(S(=O)(=O)N(C)C)C[C@H]21 |
| InChI | InChI=1S/C10H19N3O3S/c1-7-9-6-13(17(15,16)12(2)3)5-8(9)4-11-10(7)14/h7-9H,4-6H2,1-3H3,(H,11,14)/t7-,8+,9+/m1/s1 |
| InChIKey | BJACAQACNVABHG-VGMNWLOBSA-N |
| XLogP | -0.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |