C18H28N4O — CID 97370003
8-(oxan-4-ylmethyl)-2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decane (PubChem CID 97370003) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 8-(oxan-4-ylmethyl)-2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-(oxan-4-ylmethyl)-2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97370003 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 8-(oxan-4-ylmethyl)-2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decane |
| SMILES | c1cnc(N2CCC3(CCN(CC4CCOCC4)CC3)C2)nc1 |
| InChI | InChI=1S/C18H28N4O/c1-7-19-17(20-8-1)22-11-6-18(15-22)4-9-21(10-5-18)14-16-2-12-23-13-3-16/h1,7-8,16H,2-6,9-15H2 |
| InChIKey | OOTBXCBHZCISNU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |