C18H29N3OS — CID 97372125
(3S)-3-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97372125) has the molecular formula C18H29N3OS and a molecular weight of 335.52 g/mol. Its IUPAC name is (3S)-3-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3S)-3-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97372125 |
| Molecular Formula | C18H29N3OS |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (3S)-3-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | CN1CCN([C@@H]2COC3(CCN(Cc4cccs4)CC3)C2)CC1 |
| InChI | InChI=1S/C18H29N3OS/c1-19-8-10-21(11-9-19)16-13-18(22-15-16)4-6-20(7-5-18)14-17-3-2-12-23-17/h2-3,12,16H,4-11,13-15H2,1H3/t16-/m0/s1 |
| InChIKey | ONPNBMVRPWPYMW-INIZCTEOSA-N |
| XLogP | 2.12 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |