C19H21N3S — CID 973730
6-phenyl-2-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carbonitrile (PubChem CID 973730) has the molecular formula C19H21N3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 6-phenyl-2-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carbonitrile.
| Compound Name | 6-phenyl-2-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 973730 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 6-phenyl-2-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccccc2)nc1SCCN1CCCCC1 |
| InChI | InChI=1S/C19H21N3S/c20-15-17-9-10-18(16-7-3-1-4-8-16)21-19(17)23-14-13-22-11-5-2-6-12-22/h1,3-4,7-10H,2,5-6,11-14H2 |
| InChIKey | RZVXJCXBDFJZAS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |