C19H23N5O — CID 97374758
N-[(3R)-7-(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-3-yl]pyrazine-2-carboxamide (PubChem CID 97374758) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is N-[(3R)-7-(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-3-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(3R)-7-(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 97374758 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[(3R)-7-(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-3-yl]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCC12CCN(Cc1ccccn1)CC2)c1cnccn1 |
| InChI | InChI=1S/C19H23N5O/c25-18(16-13-20-9-10-22-16)23-17-4-5-19(17)6-11-24(12-7-19)14-15-3-1-2-8-21-15/h1-3,8-10,13,17H,4-7,11-12,14H2,(H,23,25)/t17-/m1/s1 |
| InChIKey | IWBWEIVQPNZDGS-QGZVFWFLSA-N |
| XLogP | 2.05 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |